cas: 223127-05-7 — see every product listed under this CAS number, including other names
6-Isopropoxynicotinic acid 96% (CAS 223127-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114893-100mg |
| cas | 223127-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1733.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114893 |
6-propan-2-yloxypyridine-3-carboxylic acid (CAS 223127-05-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 6-propan-2-yloxypyridine-3-carboxylic acid. InChIKey: OOIMOWCIYNEWCF-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 6-propan-2-yloxypyridine-3-carboxylic acid |
| InChIKey | OOIMOWCIYNEWCF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)