cas: 3589-72-8 — see every product listed under this CAS number, including other names
6-Methoxy-1-methyl-9H-pyrido[3,4-b]indole, 98% (CAS 3589-72-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603471-50MG |
| cas | 3589-72-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1138.16 Pln | |
| Fluorochem | 100mg | 1903.51 Pln | |
| Fluorochem | 250mg | 3736.20 Pln | |
| Fluorochem | 1g | 8156.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-methoxy-1-methyl-9H-pyrido[3,4-b]indole (CAS 3589-72-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 6-methoxy-1-methyl-9H-pyrido[3,4-b]indole. InChIKey: XYYVPBBISSKKQB-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 6-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| InChIKey | XYYVPBBISSKKQB-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC2=C1NC3=C2C=C(C=C3)OC |
Computed by PubChem (NCBI)