cas: 3589-72-8 — see every product listed under this CAS number, including other names
6-Methoxyharman, 98% (CAS 3589-72-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A303269-50mg |
| cas | 3589-72-8 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 1892.80 Pln | |
| AmBeed | 1g | 13291.81 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-methoxy-1-methyl-9H-pyrido[3,4-b]indole (CAS 3589-72-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 6-methoxy-1-methyl-9H-pyrido[3,4-b]indole. InChIKey: XYYVPBBISSKKQB-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 6-methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| InChIKey | XYYVPBBISSKKQB-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC2=C1NC3=C2C=C(C=C3)OC |
Computed by PubChem (NCBI)