cas: 15341-08-9 — see every product listed under this CAS number, including other names
6-Nitropiperonyl alcohol 95+% (CAS 15341-08-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A240085-1g |
| cas | 15341-08-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 592.88 Pln | |
| Ambeed | 10g | 1010.06 Pln | |
| Ambeed | 25g | 1955.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A240085 |
(6-nitro-1,3-benzodioxol-5-yl)methanol (CAS 15341-08-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: (6-nitro-1,3-benzodioxol-5-yl)methanol. InChIKey: XSKQKDTZQNFCCB-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | (6-nitro-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XSKQKDTZQNFCCB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)