Products 1260016-95-2
CAS 1260016-95-2 appears in our catalog under these names: 7–Bromo–5–fluoro–1–indanone, 7-Bromo-5-fluoro-1-indanone, 7-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one, >97%, >97%, 7-Bromo-5-fluoro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
7-bromo-5-fluoro-2,3-dihydroinden-1-one (CAS 1260016-95-2) is a chemical compound with the molecular formula C9H6BrFO and a molecular weight of 229.05 g/mol. IUPAC name: 7-bromo-5-fluoro-2,3-dihydroinden-1-one. InChIKey: QIXWPINRZMAUAE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFO |
|---|---|
| Molecular weight | 229.05 g/mol |
| IUPAC name | 7-bromo-5-fluoro-2,3-dihydroinden-1-one |
| InChIKey | QIXWPINRZMAUAE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2Br)F |
Computed by PubChem (NCBI)