cas: 892152-26-0 — see every product listed under this CAS number, including other names
7-Bromo-6-methoxy-2,3-dihydro-1H-inden-1-one, 97% (CAS 892152-26-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A199116-5g |
| cas | 892152-26-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 13441.54 Pln | |
| AmBeed | 100mg | 343.42 Pln | |
| AmBeed | 10g | 16247.35 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-bromo-6-methoxy-2,3-dihydroinden-1-one (CAS 892152-26-0) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-6-methoxy-2,3-dihydroinden-1-one. InChIKey: VRVDFHCIYLDELF-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-6-methoxy-2,3-dihydroinden-1-one |
| InChIKey | VRVDFHCIYLDELF-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCC2=O)C=C1)Br |
Computed by PubChem (NCBI)