cas: 17556-19-3 — see every product listed under this CAS number, including other names
7-Chloro-2-tetralone, 95%, 95% (CAS 17556-19-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11322I-100mg |
| cas | 17556-19-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 693.20 Pln | |
| Chemat | 1g | 1643.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-chloro-3,4-dihydro-1H-naphthalen-2-one (CAS 17556-19-3) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 7-chloro-3,4-dihydro-1H-naphthalen-2-one. InChIKey: CSIHHNSBJNDXNO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | CSIHHNSBJNDXNO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)