cas: 17556-19-3 — see every product listed under this CAS number, including other names
7-Chloro-2-tetralone, 95.0% (CAS 17556-19-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 250 mg, 5 g, 500 mg, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-30055-1 g |
| cas | 17556-19-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 2089.06 Pln | |
| MedChemExpress | 250 mg | 993.07 Pln | |
| MedChemExpress | 5 g | 5878.56 Pln | |
| MedChemExpress | 500 mg | 1429.61 Pln | |
| MedChemExpress | 100 mg | 551.89 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 95.0% |
7-chloro-3,4-dihydro-1H-naphthalen-2-one (CAS 17556-19-3) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 7-chloro-3,4-dihydro-1H-naphthalen-2-one. InChIKey: CSIHHNSBJNDXNO-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | CSIHHNSBJNDXNO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)