cas: 89793-29-3 — see every product listed under this CAS number, including other names
7-Chloro-5,6-dimethyl-(1,2,4)triazolo(1,5-a)pyrimidine, 97% (CAS 89793-29-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A705256-5g |
| cas | 89793-29-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 19534.90 Pln | |
| AmBeed | 10g | 27574.75 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 89793-29-3) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: RPHBQCUEWQSJTD-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | RPHBQCUEWQSJTD-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=NC=N2)N=C1C)Cl |
Computed by PubChem (NCBI)