CAS 80812-36-8 appears in our catalog under these names: 7-Chloro-2,5-dimethyl[1,2,4]triazolo[1,5-a]pyrimidine, 95%, 7-Chloro-2,5-dimethyl-(1,2,4)triazolo(1,5-a)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
7-chloro-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 80812-36-8) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: GLKHXXSXNAXYNL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | GLKHXXSXNAXYNL-UHFFFAOYSA-N |
| SMILES | CC1=NC2=NC(=NN2C(=C1)Cl)C |
Computed by PubChem (NCBI)