cas: 128076-63-1 — see every product listed under this CAS number, including other names
7-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98%, 98% (CAS 128076-63-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XQW-100mg |
| cas | 128076-63-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1144.40 Pln | |
| Chemat | 10g | 1653.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 128076-63-1) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 7-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: XAJRDVIVFVGXNN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 7-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | XAJRDVIVFVGXNN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)