cas: 42923-79-5 — see every product listed under this CAS number, including other names
7-Nitro-1,2,3,4-tetrahydroisoquinoline, 95% (CAS 42923-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078875-1G |
| cas | 42923-79-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 653.95 Pln | |
| Fluorochem | 25g | 1372.45 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
7-nitro-1,2,3,4-tetrahydroisoquinoline (CAS 42923-79-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-nitro-1,2,3,4-tetrahydroisoquinoline. InChIKey: YPRWYZSUBZXORL-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-nitro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | YPRWYZSUBZXORL-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)