cas: 42923-79-5 — see every product listed under this CAS number, including other names
7-Nitro-1,2,3,4-tetrahydroisoquinoline, 97%, 97% (CAS 42923-79-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYW3-250mg |
| cas | 42923-79-5 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 424.40 Pln | |
| Chemat | 25g | 842.00 Pln | |
| Chemat | 100g | 3107.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-nitro-1,2,3,4-tetrahydroisoquinoline (CAS 42923-79-5) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 7-nitro-1,2,3,4-tetrahydroisoquinoline. InChIKey: YPRWYZSUBZXORL-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 7-nitro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | YPRWYZSUBZXORL-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)