cas: 169044-97-7 — see every product listed under this CAS number, including other names
7-Nitroisoindolin-1-one, 97%, 97% (CAS 169044-97-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112YG8-100mg |
| cas | 169044-97-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 500mg | 1034.00 Pln | |
| Chemat | 1g | 1523.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-nitro-2,3-dihydroisoindol-1-one (CAS 169044-97-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 7-nitro-2,3-dihydroisoindol-1-one. InChIKey: LCDQMYJTXPCJLX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 7-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | LCDQMYJTXPCJLX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)