7-Nitroisoindolin-1-one, 97%
cas: 169044-97-7 — see every product listed under this CAS number, including other names
7-Nitroisoindolin-1-one, 97% (CAS 169044-97-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A504257-5g |
| cas | 169044-97-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6840.40 Pln | |
| AmBeed | 10g | 11748.94 Pln | |
| Fluorochem | 100mg | 799.74 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 500mg | 1684.84 Pln | |
| Fluorochem | 1g | 2497.06 Pln | |
| Fluorochem | 5g | 7380.75 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-nitro-2,3-dihydroisoindol-1-one (CAS 169044-97-7) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 7-nitro-2,3-dihydroisoindol-1-one. InChIKey: LCDQMYJTXPCJLX-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 7-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | LCDQMYJTXPCJLX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)[N+](=O)[O-])C(=O)N1 |
Computed by PubChem (NCBI)