cas: 59820-91-6 — see every product listed under this CAS number, including other names
7-bromo-2,3-dihydro-1,4-benzodioxine-6-carboxylic acid, 97% (CAS 59820-91-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F315654-250MG |
| cas | 59820-91-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 10g | 3423.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid (CAS 59820-91-6) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid. InChIKey: DMPSJWYHZMDSPL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 6-bromo-2,3-dihydro-1,4-benzodioxine-7-carboxylic acid |
| InChIKey | DMPSJWYHZMDSPL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)