cas: 406204-86-2 — see every product listed under this CAS number, including other names
8-Bromo-2,4-dichloroquinoline, 97%, 97% (CAS 406204-86-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CMNG-100mg |
| cas | 406204-86-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 798.80 Pln | |
| Chemat | 5g | 2128.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
8-bromo-2,4-dichloroquinoline (CAS 406204-86-2) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 8-bromo-2,4-dichloroquinoline. InChIKey: RRMPRAHNBHWFCZ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 8-bromo-2,4-dichloroquinoline |
| InChIKey | RRMPRAHNBHWFCZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)