cas: 688363-48-6 — see every product listed under this CAS number, including other names
8-Bromo-4H-benzo[1,4]oxazin-3-one, 98%, 98% (CAS 688363-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FHMB-100mg |
| cas | 688363-48-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 10g | 1797.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromo-4H-1,4-benzoxazin-3-one (CAS 688363-48-6) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 8-bromo-4H-1,4-benzoxazin-3-one. InChIKey: FVGSWEPMUVKUDX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 8-bromo-4H-1,4-benzoxazin-3-one |
| InChIKey | FVGSWEPMUVKUDX-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)