8-Hydroxycoumarin 98%
cas: 2442-31-1 — see every product listed under this CAS number, including other names
8-Hydroxycoumarin 98% (CAS 2442-31-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A739737-100mg |
| cas | 2442-31-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 737.50 Pln | |
| Ambeed | 1g | 2222.69 Pln | |
| Ambeed | 5g | 7551.56 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A739737 |
8-hydroxychromen-2-one (CAS 2442-31-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 8-hydroxychromen-2-one. InChIKey: DPTUTXWBBUARQB-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 8-hydroxychromen-2-one |
| InChIKey | DPTUTXWBBUARQB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)OC(=O)C=C2 |
Computed by PubChem (NCBI)