9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,6-diamine, 95%
cas: 58519-04-3 — see every product listed under this CAS number, including other names
9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,6-diamine, 95% (CAS 58519-04-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1941454-100mg |
| cas | 58519-04-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1221.44 Pln | |
| Ambeed | 5g | 3941.50 Pln | |
| BLDpharm | 100mg | 336.57 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1314.01 Pln | |
| BLDpharm | 5g | 4246.31 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 856.40 Pln | |
| Chemat | 5g | 2858.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine (CAS 58519-04-3) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine. InChIKey: KGVOLFXAKOWTCR-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine |
| InChIKey | KGVOLFXAKOWTCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3C4=C(C=C(C=C4)N)C(C2=C1)C5=C3C=C(C=C5)N |
Computed by PubChem (NCBI)