Products 58519-04-3
CAS 58519-04-3 is the registry number for 9,10-Dihydro-9,10-[1,2]benzenoanthracene-2,6-diamine, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine (CAS 58519-04-3) is a chemical compound with the molecular formula C20H16N2 and a molecular weight of 284.4 g/mol. IUPAC name: pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine. InChIKey: KGVOLFXAKOWTCR-UHFFFAOYSA-N.
| Molecular formula | C20H16N2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15,17,19-nonaene-4,11-diamine |
| InChIKey | KGVOLFXAKOWTCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C3C4=C(C=C(C=C4)N)C(C2=C1)C5=C3C=C(C=C5)N |
Computed by PubChem (NCBI)