cas: 5336-90-3 — see every product listed under this CAS number, including other names
9-ACRIDINECARBOXYLIC ACID, 97%, 97% (CAS 5336-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0J1-100mg |
| cas | 5336-90-3 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 100g | 1917.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Acridine-9-carboxylic acid (CAS 5336-90-3) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: acridine-9-carboxylic acid. InChIKey: IYRYQBAAHMBIFT-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | acridine-9-carboxylic acid |
| InChIKey | IYRYQBAAHMBIFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)C(=O)O |
Computed by PubChem (NCBI)