cas: 4261-14-7 — see every product listed under this CAS number, including other names
9-BENZYLADENINE, 98%, 98% (CAS 4261-14-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I99L-100mg |
| cas | 4261-14-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1288.40 Pln | |
| Chemat | 10g | 2378.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9-benzylpurin-6-amine (CAS 4261-14-7) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 9-benzylpurin-6-amine. InChIKey: MRHCSNNEUHXNIC-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 9-benzylpurin-6-amine |
| InChIKey | MRHCSNNEUHXNIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)