9-Hydroxyxanthene, 98%, 98%
cas: 90-46-0 — see every product listed under this CAS number, including other names
9-Hydroxyxanthene, 98%, 98% (CAS 90-46-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146SS-1g |
| cas | 90-46-0 |
| size | 1g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 304.40 Pln | |
| Chemat | 100g | 971.60 Pln | |
| Chemat | 250g | 1456.40 Pln | |
| Chemat | 500g | 2779.20 Pln | |
| Chemat | 1kg | 4970.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
9H-xanthen-9-ol (CAS 90-46-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 9H-xanthen-9-ol. InChIKey: JFRMYMMIJXLMBB-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 9H-xanthen-9-ol |
| InChIKey | JFRMYMMIJXLMBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)