cas: 90-46-0 — see every product listed under this CAS number, including other names
XANTHYDROL, 98% (CAS 90-46-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468359-1G |
| cas | 90-46-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 206.20 Pln | |
| Fluorochem | 25g | 424.87 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
9H-xanthen-9-ol (CAS 90-46-0) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: 9H-xanthen-9-ol. InChIKey: JFRMYMMIJXLMBB-UHFFFAOYSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | 9H-xanthen-9-ol |
| InChIKey | JFRMYMMIJXLMBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C3O2)O |
Computed by PubChem (NCBI)