9-Methylphenazine-1-carboxylic acid, 97%
cas: 58718-46-0 — see every product listed under this CAS number, including other names
9-Methylphenazine-1-carboxylic acid, 97% (CAS 58718-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A681915-100mg |
| cas | 58718-46-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 693.00 Pln | |
| Ambeed | 250mg | 1143.56 Pln | |
| Ambeed | 1g | 2968.06 Pln | |
| Ambeed | 5g | 10221.56 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 8507.60 Pln | |
| BLDpharm | 100mg | 680.90 Pln | |
| BLDpharm | 250mg | 1125.18 Pln | |
| BLDpharm | 1g | 2913.44 Pln | |
| BLDpharm | 5g | 10016.50 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
9-methylphenazine-1-carboxylic acid (CAS 58718-46-0) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 9-methylphenazine-1-carboxylic acid. InChIKey: JPRPEGGFLLPQJB-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 9-methylphenazine-1-carboxylic acid |
| InChIKey | JPRPEGGFLLPQJB-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N=C3C=CC=C(C3=N2)C(=O)O |
Computed by PubChem (NCBI)