cas: 6954-55-8 — see every product listed under this CAS number, including other names
9H-Fluorene-4-carboxylic acid, 96%(LC-MS),RG, 96%(LC-MS),RG (CAS 6954-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LCO-100mg |
| cas | 6954-55-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 261.20 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 894.80 Pln | |
| Chemat | 5g | 4149.20 Pln |
| purity | 96%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
9H-fluorene-4-carboxylic acid (CAS 6954-55-8) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 9H-fluorene-4-carboxylic acid. InChIKey: WJNBLUOXTBTGMB-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 9H-fluorene-4-carboxylic acid |
| InChIKey | WJNBLUOXTBTGMB-UHFFFAOYSA-N |
| SMILES | C1C2=C(C3=CC=CC=C31)C(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)