Products 1708103-76-7
CAS 1708103-76-7 appears in our catalog under these names: ARTD10/PARP10-IN-1/ 99.14% (existing batch purity), ARTD10/PARP10-IN-1. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 500mg, 10mg, 200mg.
Methyl (Z)-4-(3-carbamoylanilino)-4-oxobut-2-enoate (CAS 1708103-76-7) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: methyl (Z)-4-(3-carbamoylanilino)-4-oxobut-2-enoate. InChIKey: KXULAXICDCSUDZ-WAYWQWQTSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | methyl (Z)-4-(3-carbamoylanilino)-4-oxobut-2-enoate |
| InChIKey | KXULAXICDCSUDZ-WAYWQWQTSA-N |
| SMILES | COC(=O)/C=C\C(=O)NC1=CC=CC(=C1)C(=O)N |
Computed by PubChem (NCBI)