cas: 102-39-6 — see every product listed under this CAS number, including other names
Acetic acid, 2,2'-[1,3-phenylenebis(oxy)]bis-, 98% (CAS 102-39-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861496-1G |
| cas | 102-39-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 10g | 950.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-(carboxymethoxy)phenoxy]acetic acid (CAS 102-39-6) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 2-[3-(carboxymethoxy)phenoxy]acetic acid. InChIKey: ZVMAGJJPTALGQB-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 2-[3-(carboxymethoxy)phenoxy]acetic acid |
| InChIKey | ZVMAGJJPTALGQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)OCC(=O)O |
Computed by PubChem (NCBI)