Products 496864-14-3
CAS 496864-14-3 appears in our catalog under these names: Aloisine B/ 95.15% (existing batch purity), Aloisine B. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
6-(4-chlorophenyl)-7-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine (CAS 496864-14-3) is a chemical compound with the molecular formula C15H14ClN3 and a molecular weight of 271.74 g/mol. IUPAC name: 6-(4-chlorophenyl)-7-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine. InChIKey: GFJIABMYYUGNEC-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-7-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine |
| InChIKey | GFJIABMYYUGNEC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(NC2=NC=CN=C12)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)