Anthracene-1,4,9,10-tetraol, 96%
cas: 476-60-8 — see every product listed under this CAS number, including other names
Anthracene-1,4,9,10-tetraol, 96% (CAS 476-60-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 250mg, 1g, 5g, 500g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F324302-25G |
| cas | 476-60-8 |
| size | 25g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 232.23 Pln | |
| Fluorochem | 100g | 508.17 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 492.75 Pln | |
| Ambeed | 500g | 1210.31 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 299.60 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 25g | 247.72 Pln | |
| BLDpharm | 100g | 525.40 Pln | |
| BLDpharm | 500g | 1297.35 Pln |
properties
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Anthracene-1,4,9,10-tetrol (CAS 476-60-8) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: anthracene-1,4,9,10-tetrol. InChIKey: BKNBVEKCHVXGPH-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | anthracene-1,4,9,10-tetrol |
| InChIKey | BKNBVEKCHVXGPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C(=CC=C(C3=C2O)O)O)O |
Computed by PubChem (NCBI)