CAS 476-60-8 appears in our catalog under these names: Leucoquinizarin, Leucoquinizarin, >98.0%(HPLC), Anthracene-1,4,9,10-tetraol 96%, Anthracene-1,4,9,10-tetraol, 96%, 96%, Anthracene-1,4,9,10-tetraol, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 500g, 250mg, 1g, 5g.
Anthracene-1,4,9,10-tetrol (CAS 476-60-8) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: anthracene-1,4,9,10-tetrol. InChIKey: BKNBVEKCHVXGPH-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | anthracene-1,4,9,10-tetrol |
| InChIKey | BKNBVEKCHVXGPH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C(=CC=C(C3=C2O)O)O)O |
Computed by PubChem (NCBI)