CAS 1044870-39-4 appears in our catalog under these names: 2-(4-(2-Hydroxyethoxy)-3,5-dimethylphenyl)-5,7-dimethoxyquinazolin-4(3H)-one, 97%, RVX–208, Apabetalone/ 98.08% (existing batch purity), RVX 208, Apabetalone 99%. Offered by: Fluorochem, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 100mg, 250mg, 1g, 25mg, 10mM (in 1ml dmso).
2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one (CAS 1044870-39-4) is a chemical compound with the molecular formula C20H22N2O5 and a molecular weight of 370.4 g/mol. IUPAC name: 2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one. InChIKey: NETXMUIMUZJUTB-UHFFFAOYSA-N.
| Molecular formula | C20H22N2O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 2-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-5,7-dimethoxy-3H-quinazolin-4-one |
| InChIKey | NETXMUIMUZJUTB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCCO)C)C2=NC3=C(C(=CC(=C3)OC)OC)C(=O)N2 |
Computed by PubChem (NCBI)