Products 223445-67-8
CAS 223445-67-8 appears in our catalog under these names: Atagabalin HCl/ 99.96% (existing batch purity), Atagabalin HCl. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-[(3S,4S)-1-(aminomethyl)-3,4-dimethylcyclopentyl]acetic acid;hydrochloride (CAS 223445-67-8) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 2-[(3S,4S)-1-(aminomethyl)-3,4-dimethylcyclopentyl]acetic acid;hydrochloride. InChIKey: MJEPQHYIBKJJGY-WSZWBAFRSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | 2-[(3S,4S)-1-(aminomethyl)-3,4-dimethylcyclopentyl]acetic acid;hydrochloride |
| InChIKey | MJEPQHYIBKJJGY-WSZWBAFRSA-N |
| SMILES | C[C@H]1CC(C[C@@H]1C)(CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
Atagabalin HCl, orb1905864