cas: 156635-90-4 — see every product listed under this CAS number, including other names
B-[4-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid, 96%, 96% (CAS 156635-90-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OV0-250mg |
| cas | 156635-90-4 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1595.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid (CAS 156635-90-4) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: UCYGEGISTWJFFA-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | [4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | UCYGEGISTWJFFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)