CAS 156635-90-4 appears in our catalog under these names: 4–(4′–Methoxybenzyloxy)phenylboronic acid, 4-(4'-Methoxybenzyloxy)phenylboronic acid, 96%, (4-((4-Methoxybenzyl)oxy)phenyl)boronic acid, 96%, B-[4-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid, 96%, 96%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 250mg.
[4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid (CAS 156635-90-4) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: UCYGEGISTWJFFA-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | [4-[(4-methoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | UCYGEGISTWJFFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)