Products 2121513-91-3
CAS 2121513-91-3 appears in our catalog under these names: 3-Benzyloxy-2-methoxyphenylboronic acid, 3-Benzyloxy-2-methoxyphenylboronic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
(2-methoxy-3-phenylmethoxyphenyl)boronic acid (CAS 2121513-91-3) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: (2-methoxy-3-phenylmethoxyphenyl)boronic acid. InChIKey: LRGJCYZIQBZISE-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | (2-methoxy-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | LRGJCYZIQBZISE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)OCC2=CC=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)