CAS 243990-54-7 appears in our catalog under these names: 3-(Benzyloxy)-4-methoxyphenylboronic acid, 95%, (3–(Benzyloxy)–4–methoxyphenyl)boronic acid, (3-(Benzyloxy)-4-methoxyphenyl)boronic acid 95%, (3-(Benzyloxy)-4-methoxyphenyl)boronic acid, 95%, 95%, (3-(Benzyloxy)-4-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(4-methoxy-3-phenylmethoxyphenyl)boronic acid (CAS 243990-54-7) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: (4-methoxy-3-phenylmethoxyphenyl)boronic acid. InChIKey: GKHSIZCQILKQCU-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | (4-methoxy-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | GKHSIZCQILKQCU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)