Products 211495-28-2

CAS 211495-28-2 is the registry number for 4-Benzyloxy-2-methoxyphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(2-methoxy-4-phenylmethoxyphenyl)boronic acid (CAS 211495-28-2) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: (2-methoxy-4-phenylmethoxyphenyl)boronic acid. InChIKey: OCRDUFMMMZJZQV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15BO4
Molecular weight258.08 g/mol
IUPAC name(2-methoxy-4-phenylmethoxyphenyl)boronic acid
InChIKeyOCRDUFMMMZJZQV-UHFFFAOYSA-N
SMILESB(C1=C(C=C(C=C1)OCC2=CC=CC=C2)OC)(O)O

Computed by PubChem (NCBI)