Products 1451392-16-7

CAS 1451392-16-7 is the registry number for 2',6'-Dimethoxybiphenyl-2-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

[2-(2,6-dimethoxyphenyl)phenyl]boronic acid (CAS 1451392-16-7) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: [2-(2,6-dimethoxyphenyl)phenyl]boronic acid. InChIKey: PGAXAVPYFVVDAH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15BO4
Molecular weight258.08 g/mol
IUPAC name[2-(2,6-dimethoxyphenyl)phenyl]boronic acid
InChIKeyPGAXAVPYFVVDAH-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1C2=C(C=CC=C2OC)OC)(O)O

Computed by PubChem (NCBI)