Products 243990-53-6
CAS 243990-53-6 is the registry number for (4-(Benzyloxy)-3-methoxyphenyl)boronic acid, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g, 100g.
(3-methoxy-4-phenylmethoxyphenyl)boronic acid (CAS 243990-53-6) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: (3-methoxy-4-phenylmethoxyphenyl)boronic acid. InChIKey: PBVVDNNISDIUSU-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | (3-methoxy-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | PBVVDNNISDIUSU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(benzyloxy)-3-methoxybenzeneboronic acid, 4-Benzyloxy-3-methoxyphenylboronic acid, (4-(Benzyloxy)-3-methoxyphenyl)boronic acid, 4-Benzyloxy-3-methoxybenzeneboronic acid, 4-(benzyloxy)-3-methoxyphenylboronic acid, (3-methoxy-4-phenylmethoxyphenyl)boronic acid, [4-(benzyloxy)-3-methoxyphenyl]boronic acid, 4-(benzyloxy)-3-methoxybenzene boronic acid, (4-(Benzyloxy)-3-methoxyphenyl)boronicacid, PBVVDNNISDIUSU-UHFFFAOYSA-N