CAS 1072951-89-3 appears in our catalog under these names: 3-(4-Methoxybenzyloxy)phenylboronic acid, 96%, 3-(4-Methoxybenzyloxy)phenylboronic acid, 95%, 95%, (3-((4-Methoxybenzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g.
[3-[(4-methoxyphenyl)methoxy]phenyl]boronic acid (CAS 1072951-89-3) is a chemical compound with the molecular formula C14H15BO4 and a molecular weight of 258.08 g/mol. IUPAC name: [3-[(4-methoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: BBNOCVPPEAVHKK-UHFFFAOYSA-N.
| Molecular formula | C14H15BO4 |
|---|---|
| Molecular weight | 258.08 g/mol |
| IUPAC name | [3-[(4-methoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | BBNOCVPPEAVHKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)