CAS 27918-19-0 appears in our catalog under these names: 4-Sulfonamide-Phenylhydrazine Hydrochloride, 4-Sulfonamidephenylhydrazine hydrochloride, 4-Hydrazinylbenzenesulfonamide xhydrochloride, 98%, 98%, Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (1:?), 98%. Offered by: Chemat Brand, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 100g, 50g, 250g, 500g, 100mg, 250mg, 5g.
4-hydrazinylbenzenesulfonamide;hydrochloride (CAS 27918-19-0) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 4-hydrazinylbenzenesulfonamide;hydrochloride. InChIKey: IKEURONJLPUALY-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 4-hydrazinylbenzenesulfonamide;hydrochloride |
| InChIKey | IKEURONJLPUALY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)