CAS 935862-81-0 is the registry number for 2-(Chloromethyl)-N,N-dimethyl-1H-imidazole-1-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(chloromethyl)-N,N-dimethylimidazole-1-sulfonamide (CAS 935862-81-0) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 2-(chloromethyl)-N,N-dimethylimidazole-1-sulfonamide. InChIKey: XNCUDKQCGJWCGU-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 2-(chloromethyl)-N,N-dimethylimidazole-1-sulfonamide |
| InChIKey | XNCUDKQCGJWCGU-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)N1C=CN=C1CCl |
Computed by PubChem (NCBI)