CAS 2138572-96-8 is the registry number for 5,​6,​7,​8-​Tetrahydro-1H-​pyrido(4,​3-​c)​(1,​2,​6)​thiadiazine 2,​2-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6,7,8-tetrahydro-1H-pyrido[4,3-c][1,2,6]thiadiazine 2,2-dioxide;hydrochloride (CAS 2138572-96-8) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 5,6,7,8-tetrahydro-1H-pyrido[4,3-c][1,2,6]thiadiazine 2,2-dioxide;hydrochloride. InChIKey: QSFPGQKVTNGWCQ-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-1H-pyrido[4,3-c][1,2,6]thiadiazine 2,2-dioxide;hydrochloride |
| InChIKey | QSFPGQKVTNGWCQ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NS(=O)(=O)N=C2.Cl |
Computed by PubChem (NCBI)