CAS 17852-52-7 appears in our catalog under these names: Celecoxib Impurity 10 HCl, Celecoxib Intermediate, (4-(Aminosulfonyl)phenyl)hydrazine Hydrochloride, (4-Sulfamoylphenyl)hydrazine Hydrochloride, >95% (HPLC), 4–Hydrazinobenzenesulfonamide Hydrochloride. Offered by: Chemat Brand, Mikromol, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 25mg, 10g, 1g, 2,5g, 500g, 50g, 2.5g.
4-hydrazinylbenzenesulfonamide;hydrochloride (CAS 17852-52-7) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 4-hydrazinylbenzenesulfonamide;hydrochloride. InChIKey: IKEURONJLPUALY-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 4-hydrazinylbenzenesulfonamide;hydrochloride |
| InChIKey | IKEURONJLPUALY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN)S(=O)(=O)N.Cl |
Computed by PubChem (NCBI)