Products 1332495-34-7

CAS 1332495-34-7 is the registry number for 2-Amino-6h-[1,3,4]thiadiazine-5-carboxylic acid ethyl ester hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-6H-1,3,4-thiadiazine-5-carboxylate;hydrochloride (CAS 1332495-34-7) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: ethyl 2-amino-6H-1,3,4-thiadiazine-5-carboxylate;hydrochloride. InChIKey: RCYOJOMNQNAQIL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10ClN3O2S
Molecular weight223.68 g/mol
IUPAC nameethyl 2-amino-6H-1,3,4-thiadiazine-5-carboxylate;hydrochloride
InChIKeyRCYOJOMNQNAQIL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NN=C(SC1)N.Cl

Computed by PubChem (NCBI)