CAS 1220039-75-7 appears in our catalog under these names: 3-Hydrazinylbenzenesulfonamide hydrochloride, 97%, 97%, 3-Hydrazinylbenzenesulfonamide hydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-hydrazinylbenzenesulfonamide;hydrochloride (CAS 1220039-75-7) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 3-hydrazinylbenzenesulfonamide;hydrochloride. InChIKey: LMBJEXGDBXGUFM-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 3-hydrazinylbenzenesulfonamide;hydrochloride |
| InChIKey | LMBJEXGDBXGUFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)NN.Cl |
Computed by PubChem (NCBI)