CAS 59689-65-5 appears in our catalog under these names: 5-(tert-Butyl)-1H-1,2,4-triazole-3-sulfonyl chloride, 95+%, 5-tert-Butyl-4H-1,2,4-triazole-3-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-tert-butyl-1H-1,2,4-triazole-3-sulfonyl chloride (CAS 59689-65-5) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 5-tert-butyl-1H-1,2,4-triazole-3-sulfonyl chloride. InChIKey: GEXZYDSRMARZCN-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 5-tert-butyl-1H-1,2,4-triazole-3-sulfonyl chloride |
| InChIKey | GEXZYDSRMARZCN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NN1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)