Products 2639416-63-8
CAS 2639416-63-8 is the registry number for 4-Chloro-1-ethyl-3-methyl-1H-pyrazole-5-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-1-ethyl-3-methylpyrazole-5-sulfonamide (CAS 2639416-63-8) is a chemical compound with the molecular formula C6H10ClN3O2S and a molecular weight of 223.68 g/mol. IUPAC name: 4-chloro-1-ethyl-3-methylpyrazole-5-sulfonamide. InChIKey: ROVFWTBRLKWJAV-UHFFFAOYSA-N.
| Molecular formula | C6H10ClN3O2S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 4-chloro-1-ethyl-3-methylpyrazole-5-sulfonamide |
| InChIKey | ROVFWTBRLKWJAV-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)